C12H24N6O — CID 114150415
1-(dimethylamino)-3-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-2-methylpropan-2-ol (PubChem CID 114150415) has the molecular formula C12H24N6O and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(dimethylamino)-3-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-2-methylpropan-2-ol.
| Compound Name | 1-(dimethylamino)-3-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-2-methylpropan-2-ol |
|---|---|
| PubChem CID | 114150415 |
| Molecular Formula | C12H24N6O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 1-(dimethylamino)-3-[(6-hydrazinyl-2,5-dimethylpyrimidin-4-yl)amino]-2-methylpropan-2-ol |
| SMILES | Cc1nc(NN)c(C)c(NCC(C)(O)CN(C)C)n1 |
| InChI | InChI=1S/C12H24N6O/c1-8-10(15-9(2)16-11(8)17-13)14-6-12(3,19)7-18(4)5/h19H,6-7,13H2,1-5H3,(H2,14,15,16,17) |
| InChIKey | SECAIVUTBZUUNN-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 99.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|