About 4-chloro-N-(2,2-difluoro-3-hydroxypropyl)-1-methylpyrazole-5-sulfonamide
4-chloro-N-(2,2-difluoro-3-hydroxypropyl)-1-methylpyrazole-5-sulfonamide (PubChem CID 114150483) has the molecular formula C7H10ClF2N3O3S
and a molecular weight of 289.69 g/mol. Its IUPAC name is 4-chloro-N-(2,2-difluoro-3-hydroxypropyl)-1-methylpyrazole-5-sulfonamide.
Molecular Properties
| Compound Name | 4-chloro-N-(2,2-difluoro-3-hydroxypropyl)-1-methylpyrazole-5-sulfonamide |
| PubChem CID | 114150483 |
| Molecular Formula | C7H10ClF2N3O3S |
| Molecular Weight | 289.69 g/mol |
| Exact Mass | 289.01 |
| IUPAC Name | 4-chloro-N-(2,2-difluoro-3-hydroxypropyl)-1-methylpyrazole-5-sulfonamide |
| SMILES | Cn1ncc(Cl)c1S(=O)(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C7H10ClF2N3O3S/c1-13-6(5(8)2-11-13)17(15,16)12-3-7(9,10)4-14/h2,12,14H,3-4H2,1H3 |
| InChIKey | JRUJGWBFQUCNRB-UHFFFAOYSA-N |
| XLogP | -0.02 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.69 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-chloro-N-(2,2-difluoro-3-hydroxypropyl)-1-methylpyrazole-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-N-(2,2-difluoro-3-hydroxypropyl)-1-methylpyrazole-5-sulfonamide?
The IUPAC name of 4-chloro-N-(2,2-difluoro-3-hydroxypropyl)-1-methylpyrazole-5-sulfonamide (CID 114150483) is 4-chloro-N-(2,2-difluoro-3-hydroxypropyl)-1-methylpyrazole-5-sulfonamide.
What is the SMILES notation for 4-chloro-N-(2,2-difluoro-3-hydroxypropyl)-1-methylpyrazole-5-sulfonamide?
The canonical SMILES for 4-chloro-N-(2,2-difluoro-3-hydroxypropyl)-1-methylpyrazole-5-sulfonamide is Cn1ncc(Cl)c1S(=O)(=O)NCC(F)(F)CO.
What is the InChIKey of 4-chloro-N-(2,2-difluoro-3-hydroxypropyl)-1-methylpyrazole-5-sulfonamide?
The InChIKey is JRUJGWBFQUCNRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClF2N3O3S/c1-13-6(5(8)2-11-13)17(15,16)12-3-7(9,10)4-14/h2,12,14H,3-4H2,1H3.
What are the key properties of 4-chloro-N-(2,2-difluoro-3-hydroxypropyl)-1-methylpyrazole-5-sulfonamide?
4-chloro-N-(2,2-difluoro-3-hydroxypropyl)-1-methylpyrazole-5-sulfonamide has a molecular weight of 289.69 g/mol, XLogP of -0.02, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-N-(2,2-difluoro-3-hydroxypropyl)-1-methylpyrazole-5-sulfonamide is sourced from PubChem (CID 114150483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).