C12H17FN2O3 — CID 114150752
N-(4-amino-1-methoxybutan-2-yl)-5-fluoro-2-hydroxybenzamide (PubChem CID 114150752) has the molecular formula C12H17FN2O3 and a molecular weight of 256.28 g/mol. Its IUPAC name is N-(4-amino-1-methoxybutan-2-yl)-5-fluoro-2-hydroxybenzamide.
| Compound Name | N-(4-amino-1-methoxybutan-2-yl)-5-fluoro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 114150752 |
| Molecular Formula | C12H17FN2O3 |
| Molecular Weight | 256.28 g/mol |
| Exact Mass | 256.12 |
| IUPAC Name | N-(4-amino-1-methoxybutan-2-yl)-5-fluoro-2-hydroxybenzamide |
| SMILES | COCC(CCN)NC(=O)c1cc(F)ccc1O |
| InChI | InChI=1S/C12H17FN2O3/c1-18-7-9(4-5-14)15-12(17)10-6-8(13)2-3-11(10)16/h2-3,6,9,16H,4-5,7,14H2,1H3,(H,15,17) |
| InChIKey | HIPZPJFELYEBGT-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.28 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |