C11H16N4OS — CID 114151096
3-amino-6-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]pyridine-2-carbonitrile (PubChem CID 114151096) has the molecular formula C11H16N4OS and a molecular weight of 252.34 g/mol. Its IUPAC name is 3-amino-6-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]pyridine-2-carbonitrile.
| Compound Name | 3-amino-6-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 114151096 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | 3-amino-6-[(4-hydroxy-3-methylsulfanylbutan-2-yl)amino]pyridine-2-carbonitrile |
| SMILES | CSC(CO)C(C)Nc1ccc(N)c(C#N)n1 |
| InChI | InChI=1S/C11H16N4OS/c1-7(10(6-16)17-2)14-11-4-3-8(13)9(5-12)15-11/h3-4,7,10,16H,6,13H2,1-2H3,(H,14,15) |
| InChIKey | YRFJDYBCQBGTEI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 94.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |