C11H17BrO4 — CID 11415132
(4aR,7R,9aS)-7-bromo-6,6,9a-trimethyl-4a,7,8,9-tetrahydro-4H-[1,3]dioxino[5,4-b]oxepin-2-one (PubChem CID 11415132) has the molecular formula C11H17BrO4 and a molecular weight of 293.16 g/mol. Its IUPAC name is (4aR,7R,9aS)-7-bromo-6,6,9a-trimethyl-4a,7,8,9-tetrahydro-4H-[1,3]dioxino[5,4-b]oxepin-2-one.
| Compound Name | (4aR,7R,9aS)-7-bromo-6,6,9a-trimethyl-4a,7,8,9-tetrahydro-4H-[1,3]dioxino[5,4-b]oxepin-2-one |
|---|---|
| PubChem CID | 11415132 |
| Molecular Formula | C11H17BrO4 |
| Molecular Weight | 293.16 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | (4aR,7R,9aS)-7-bromo-6,6,9a-trimethyl-4a,7,8,9-tetrahydro-4H-[1,3]dioxino[5,4-b]oxepin-2-one |
| SMILES | CC1(C)O[C@@H]2COC(=O)O[C@@]2(C)CC[C@H]1Br |
| InChI | InChI=1S/C11H17BrO4/c1-10(2)7(12)4-5-11(3)8(15-10)6-14-9(13)16-11/h7-8H,4-6H2,1-3H3/t7-,8-,11+/m1/s1 |
| InChIKey | ABDYBBXBXTVXSO-XLDPMVHQSA-N |
| XLogP | 2.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.16 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|