C15H18O6 — CID 11415167
(1S,2S,6S,7R,8S,9R,11S)-7-hydroxy-2,6,9-trimethyl-4,10,13-trioxapentacyclo[6.4.3.01,8.02,6.09,11]pentadecane-5,14-dione (PubChem CID 11415167) has the molecular formula C15H18O6 and a molecular weight of 294.30 g/mol. Its IUPAC name is (1S,2S,6S,7R,8S,9R,11S)-7-hydroxy-2,6,9-trimethyl-4,10,13-trioxapentacyclo[6.4.3.01,8.02,6.09,11]pentadecane-5,14-dione.
| Compound Name | (1S,2S,6S,7R,8S,9R,11S)-7-hydroxy-2,6,9-trimethyl-4,10,13-trioxapentacyclo[6.4.3.01,8.02,6.09,11]pentadecane-5,14-dione |
|---|---|
| PubChem CID | 11415167 |
| Molecular Formula | C15H18O6 |
| Molecular Weight | 294.30 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | (1S,2S,6S,7R,8S,9R,11S)-7-hydroxy-2,6,9-trimethyl-4,10,13-trioxapentacyclo[6.4.3.01,8.02,6.09,11]pentadecane-5,14-dione |
| SMILES | C[C@@]12COC(=O)[C@]1(C)[C@H](O)[C@@]13CC(=O)O[C@@]21C[C@@H]1O[C@@]13C |
| InChI | InChI=1S/C15H18O6/c1-11-6-19-10(18)12(11,2)9(17)14-5-8(16)21-15(11,14)4-7-13(14,3)20-7/h7,9,17H,4-6H2,1-3H3/t7-,9-,11+,12-,13-,14+,15-/m0/s1 |
| InChIKey | KJYHZCFLCCVOJO-KKYMBWLCSA-N |
| XLogP | 0.16 |
| TPSA | 85.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.30 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|