C11H22N2O4 — CID 114151968
N-(4-hydroxy-1-methoxybutan-2-yl)-2-morpholin-2-ylacetamide (PubChem CID 114151968) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is N-(4-hydroxy-1-methoxybutan-2-yl)-2-morpholin-2-ylacetamide.
| Compound Name | N-(4-hydroxy-1-methoxybutan-2-yl)-2-morpholin-2-ylacetamide |
|---|---|
| PubChem CID | 114151968 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | N-(4-hydroxy-1-methoxybutan-2-yl)-2-morpholin-2-ylacetamide |
| SMILES | COCC(CCO)NC(=O)CC1CNCCO1 |
| InChI | InChI=1S/C11H22N2O4/c1-16-8-9(2-4-14)13-11(15)6-10-7-12-3-5-17-10/h9-10,12,14H,2-8H2,1H3,(H,13,15) |
| InChIKey | VMXNNAOFQVAVFG-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |