C11H22N2O4 — CID 114151979
4-amino-N-(4-hydroxy-1-methoxybutan-2-yl)-3-methyloxolane-3-carboxamide (PubChem CID 114151979) has the molecular formula C11H22N2O4 and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-amino-N-(4-hydroxy-1-methoxybutan-2-yl)-3-methyloxolane-3-carboxamide.
| Compound Name | 4-amino-N-(4-hydroxy-1-methoxybutan-2-yl)-3-methyloxolane-3-carboxamide |
|---|---|
| PubChem CID | 114151979 |
| Molecular Formula | C11H22N2O4 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.16 |
| IUPAC Name | 4-amino-N-(4-hydroxy-1-methoxybutan-2-yl)-3-methyloxolane-3-carboxamide |
| SMILES | COCC(CCO)NC(=O)C1(C)COCC1N |
| InChI | InChI=1S/C11H22N2O4/c1-11(7-17-6-9(11)12)10(15)13-8(3-4-14)5-16-2/h8-9,14H,3-7,12H2,1-2H3,(H,13,15) |
| InChIKey | RXJUWRKLPIOANW-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |