About 3-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol
3-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol (PubChem CID 114152264) has the molecular formula C12H22N4O2
and a molecular weight of 254.33 g/mol. Its IUPAC name is 3-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol.
Molecular Properties
| Compound Name | 3-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol |
| PubChem CID | 114152264 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 3-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol |
| SMILES | CNc1nc(C)nc(NC(CCO)COC)c1C |
| InChI | InChI=1S/C12H22N4O2/c1-8-11(13-3)14-9(2)15-12(8)16-10(5-6-17)7-18-4/h10,17H,5-7H2,1-4H3,(H2,13,14,15,16) |
| InChIKey | WNKVVJAADOSBOT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol?
The IUPAC name of 3-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol (CID 114152264) is 3-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol.
What is the SMILES notation for 3-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol?
The canonical SMILES for 3-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol is CNc1nc(C)nc(NC(CCO)COC)c1C.
What is the InChIKey of 3-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol?
The InChIKey is WNKVVJAADOSBOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N4O2/c1-8-11(13-3)14-9(2)15-12(8)16-10(5-6-17)7-18-4/h10,17H,5-7H2,1-4H3,(H2,13,14,15,16).
What are the key properties of 3-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol?
3-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol has a molecular weight of 254.33 g/mol, XLogP of 0.94, 7 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[2,5-dimethyl-6-(methylamino)pyrimidin-4-yl]amino]-4-methoxybutan-1-ol is sourced from PubChem (CID 114152264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).