C12H22N4O2 — CID 114152424
4-amino-1-ethyl-N-(1-hydroxy-3-methylpentan-3-yl)pyrazole-3-carboxamide (PubChem CID 114152424) has the molecular formula C12H22N4O2 and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-amino-1-ethyl-N-(1-hydroxy-3-methylpentan-3-yl)pyrazole-3-carboxamide.
| Compound Name | 4-amino-1-ethyl-N-(1-hydroxy-3-methylpentan-3-yl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 114152424 |
| Molecular Formula | C12H22N4O2 |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | 4-amino-1-ethyl-N-(1-hydroxy-3-methylpentan-3-yl)pyrazole-3-carboxamide |
| SMILES | CCn1cc(N)c(C(=O)NC(C)(CC)CCO)n1 |
| InChI | InChI=1S/C12H22N4O2/c1-4-12(3,6-7-17)14-11(18)10-9(13)8-16(5-2)15-10/h8,17H,4-7,13H2,1-3H3,(H,14,18) |
| InChIKey | GTLIKTZNQGEDEI-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 93.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |