C10H11BrF2N2O2 — CID 114152440
3-amino-5-bromo-N-(2,2-difluoro-3-hydroxypropyl)benzamide (PubChem CID 114152440) has the molecular formula C10H11BrF2N2O2 and a molecular weight of 309.11 g/mol. Its IUPAC name is 3-amino-5-bromo-N-(2,2-difluoro-3-hydroxypropyl)benzamide.
| Compound Name | 3-amino-5-bromo-N-(2,2-difluoro-3-hydroxypropyl)benzamide |
|---|---|
| PubChem CID | 114152440 |
| Molecular Formula | C10H11BrF2N2O2 |
| Molecular Weight | 309.11 g/mol |
| Exact Mass | 308.00 |
| IUPAC Name | 3-amino-5-bromo-N-(2,2-difluoro-3-hydroxypropyl)benzamide |
| SMILES | Nc1cc(Br)cc(C(=O)NCC(F)(F)CO)c1 |
| InChI | InChI=1S/C10H11BrF2N2O2/c11-7-1-6(2-8(14)3-7)9(17)15-4-10(12,13)5-16/h1-3,16H,4-5,14H2,(H,15,17) |
| InChIKey | CRFCFIFIGJLDRM-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.11 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|