About N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-chloro-3-methylpentan-3-amine
N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-chloro-3-methylpentan-3-amine (PubChem CID 114152909) has the molecular formula C14H25BrClN3
and a molecular weight of 350.73 g/mol. Its IUPAC name is N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-chloro-3-methylpentan-3-amine.
Molecular Properties
| Compound Name | N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-chloro-3-methylpentan-3-amine |
| PubChem CID | 114152909 |
| Molecular Formula | C14H25BrClN3 |
| Molecular Weight | 350.73 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-chloro-3-methylpentan-3-amine |
| SMILES | CCc1nn(CC)c(CNC(C)(CC)CCCl)c1Br |
| InChI | InChI=1S/C14H25BrClN3/c1-5-11-13(15)12(19(7-3)18-11)10-17-14(4,6-2)8-9-16/h17H,5-10H2,1-4H3 |
| InChIKey | BEUYBFPACFEIFH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.73 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-chloro-3-methylpentan-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-chloro-3-methylpentan-3-amine?
The IUPAC name of N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-chloro-3-methylpentan-3-amine (CID 114152909) is N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-chloro-3-methylpentan-3-amine.
What is the SMILES notation for N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-chloro-3-methylpentan-3-amine?
The canonical SMILES for N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-chloro-3-methylpentan-3-amine is CCc1nn(CC)c(CNC(C)(CC)CCCl)c1Br.
What is the InChIKey of N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-chloro-3-methylpentan-3-amine?
The InChIKey is BEUYBFPACFEIFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H25BrClN3/c1-5-11-13(15)12(19(7-3)18-11)10-17-14(4,6-2)8-9-16/h17H,5-10H2,1-4H3.
What are the key properties of N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-chloro-3-methylpentan-3-amine?
N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-chloro-3-methylpentan-3-amine has a molecular weight of 350.73 g/mol, XLogP of 4.12, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-bromo-1,3-diethylpyrazol-5-yl)methyl]-1-chloro-3-methylpentan-3-amine is sourced from PubChem (CID 114152909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).