C10H11F2N3O3 — CID 114152939
6-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]-3H-1,3-benzoxazol-2-one (PubChem CID 114152939) has the molecular formula C10H11F2N3O3 and a molecular weight of 259.21 g/mol. Its IUPAC name is 6-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]-3H-1,3-benzoxazol-2-one.
| Compound Name | 6-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]-3H-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 114152939 |
| Molecular Formula | C10H11F2N3O3 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.08 |
| IUPAC Name | 6-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]-3H-1,3-benzoxazol-2-one |
| SMILES | Nc1cc2oc(=O)[nH]c2cc1NCC(F)(F)CO |
| InChI | InChI=1S/C10H11F2N3O3/c11-10(12,4-16)3-14-6-2-7-8(1-5(6)13)18-9(17)15-7/h1-2,14,16H,3-4,13H2,(H,15,17) |
| InChIKey | ICHOZBYYTXKIMW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 104.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|