About 3-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]benzenesulfonamide
3-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]benzenesulfonamide (PubChem CID 114152942) has the molecular formula C9H13F2N3O3S
and a molecular weight of 281.28 g/mol. Its IUPAC name is 3-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]benzenesulfonamide.
Molecular Properties
| Compound Name | 3-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]benzenesulfonamide |
| PubChem CID | 114152942 |
| Molecular Formula | C9H13F2N3O3S |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.06 |
| IUPAC Name | 3-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]benzenesulfonamide |
| SMILES | Nc1cc(NCC(F)(F)CO)cc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C9H13F2N3O3S/c10-9(11,5-15)4-14-7-1-6(12)2-8(3-7)18(13,16)17/h1-3,14-15H,4-5,12H2,(H2,13,16,17) |
| InChIKey | MZYXKXUUXQJJGR-UHFFFAOYSA-N |
| XLogP | -0.04 |
| TPSA | 118.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | -0.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]benzenesulfonamide?
The IUPAC name of 3-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]benzenesulfonamide (CID 114152942) is 3-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]benzenesulfonamide.
What is the SMILES notation for 3-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]benzenesulfonamide?
The canonical SMILES for 3-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]benzenesulfonamide is Nc1cc(NCC(F)(F)CO)cc(S(N)(=O)=O)c1.
What is the InChIKey of 3-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]benzenesulfonamide?
The InChIKey is MZYXKXUUXQJJGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13F2N3O3S/c10-9(11,5-15)4-14-7-1-6(12)2-8(3-7)18(13,16)17/h1-3,14-15H,4-5,12H2,(H2,13,16,17).
What are the key properties of 3-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]benzenesulfonamide?
3-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]benzenesulfonamide has a molecular weight of 281.28 g/mol, XLogP of -0.04, 5 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-5-[(2,2-difluoro-3-hydroxypropyl)amino]benzenesulfonamide is sourced from PubChem (CID 114152942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).