About N-[2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]thiophen-3-yl]acetamide
N-[2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]thiophen-3-yl]acetamide (PubChem CID 114153789) has the molecular formula C10H14F2N2O2S
and a molecular weight of 264.30 g/mol. Its IUPAC name is N-[2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]thiophen-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]thiophen-3-yl]acetamide |
| PubChem CID | 114153789 |
| Molecular Formula | C10H14F2N2O2S |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | N-[2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]thiophen-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccsc1CNCC(F)(F)CO |
| InChI | InChI=1S/C10H14F2N2O2S/c1-7(16)14-8-2-3-17-9(8)4-13-5-10(11,12)6-15/h2-3,13,15H,4-6H2,1H3,(H,14,16) |
| InChIKey | MOPMQFCOXUXGJF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]thiophen-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]thiophen-3-yl]acetamide?
The IUPAC name of N-[2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]thiophen-3-yl]acetamide (CID 114153789) is N-[2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]thiophen-3-yl]acetamide.
What is the SMILES notation for N-[2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]thiophen-3-yl]acetamide?
The canonical SMILES for N-[2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]thiophen-3-yl]acetamide is CC(=O)Nc1ccsc1CNCC(F)(F)CO.
What is the InChIKey of N-[2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]thiophen-3-yl]acetamide?
The InChIKey is MOPMQFCOXUXGJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14F2N2O2S/c1-7(16)14-8-2-3-17-9(8)4-13-5-10(11,12)6-15/h2-3,13,15H,4-6H2,1H3,(H,14,16).
What are the key properties of N-[2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]thiophen-3-yl]acetamide?
N-[2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]thiophen-3-yl]acetamide has a molecular weight of 264.30 g/mol, XLogP of 1.42, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[[(2,2-difluoro-3-hydroxypropyl)amino]methyl]thiophen-3-yl]acetamide is sourced from PubChem (CID 114153789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).