C15H28N2S — CID 114153856
3-(aminomethyl)-N-[2-(cyclopenten-1-yl)ethyl]-5,5-dimethylthian-3-amine (PubChem CID 114153856) has the molecular formula C15H28N2S and a molecular weight of 268.47 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[2-(cyclopenten-1-yl)ethyl]-5,5-dimethylthian-3-amine.
| Compound Name | 3-(aminomethyl)-N-[2-(cyclopenten-1-yl)ethyl]-5,5-dimethylthian-3-amine |
|---|---|
| PubChem CID | 114153856 |
| Molecular Formula | C15H28N2S |
| Molecular Weight | 268.47 g/mol |
| Exact Mass | 268.20 |
| IUPAC Name | 3-(aminomethyl)-N-[2-(cyclopenten-1-yl)ethyl]-5,5-dimethylthian-3-amine |
| SMILES | CC1(C)CSCC(CN)(NCCC2=CCCC2)C1 |
| InChI | InChI=1S/C15H28N2S/c1-14(2)9-15(10-16,12-18-11-14)17-8-7-13-5-3-4-6-13/h5,17H,3-4,6-12,16H2,1-2H3 |
| InChIKey | JZDJRDOAZLXXOA-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|