C20H30O2 — CID 11415420
(1S,2R,6S,7R)-5-methoxy-4-nonyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one (PubChem CID 11415420) has the molecular formula C20H30O2 and a molecular weight of 302.46 g/mol. Its IUPAC name is (1S,2R,6S,7R)-5-methoxy-4-nonyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one.
| Compound Name | (1S,2R,6S,7R)-5-methoxy-4-nonyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
|---|---|
| PubChem CID | 11415420 |
| Molecular Formula | C20H30O2 |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | (1S,2R,6S,7R)-5-methoxy-4-nonyltricyclo[5.2.1.02,6]deca-4,8-dien-3-one |
| SMILES | CCCCCCCCCC1=C(OC)[C@@H]2[C@H](C1=O)[C@@H]1C=C[C@H]2C1 |
| InChI | InChI=1S/C20H30O2/c1-3-4-5-6-7-8-9-10-16-19(21)17-14-11-12-15(13-14)18(17)20(16)22-2/h11-12,14-15,17-18H,3-10,13H2,1-2H3/t14-,15+,17-,18+/m1/s1 |
| InChIKey | RDMQJJQAJHWRSS-ATLSCFEFSA-N |
| XLogP | 5.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|