About 3-amino-N-(2,2-difluoro-3-hydroxypropyl)bicyclo[2.2.1]heptane-2-carboxamide
3-amino-N-(2,2-difluoro-3-hydroxypropyl)bicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 114154225) has the molecular formula C11H18F2N2O2
and a molecular weight of 248.27 g/mol. Its IUPAC name is 3-amino-N-(2,2-difluoro-3-hydroxypropyl)bicyclo[2.2.1]heptane-2-carboxamide.
Molecular Properties
| Compound Name | 3-amino-N-(2,2-difluoro-3-hydroxypropyl)bicyclo[2.2.1]heptane-2-carboxamide |
| PubChem CID | 114154225 |
| Molecular Formula | C11H18F2N2O2 |
| Molecular Weight | 248.27 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-amino-N-(2,2-difluoro-3-hydroxypropyl)bicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | NC1C2CCC(C2)C1C(=O)NCC(F)(F)CO |
| InChI | InChI=1S/C11H18F2N2O2/c12-11(13,5-16)4-15-10(17)8-6-1-2-7(3-6)9(8)14/h6-9,16H,1-5,14H2,(H,15,17) |
| InChIKey | OIHMZFBCQJRYSE-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.27 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-amino-N-(2,2-difluoro-3-hydroxypropyl)bicyclo[2.2.1]heptane-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-N-(2,2-difluoro-3-hydroxypropyl)bicyclo[2.2.1]heptane-2-carboxamide?
The IUPAC name of 3-amino-N-(2,2-difluoro-3-hydroxypropyl)bicyclo[2.2.1]heptane-2-carboxamide (CID 114154225) is 3-amino-N-(2,2-difluoro-3-hydroxypropyl)bicyclo[2.2.1]heptane-2-carboxamide.
What is the SMILES notation for 3-amino-N-(2,2-difluoro-3-hydroxypropyl)bicyclo[2.2.1]heptane-2-carboxamide?
The canonical SMILES for 3-amino-N-(2,2-difluoro-3-hydroxypropyl)bicyclo[2.2.1]heptane-2-carboxamide is NC1C2CCC(C2)C1C(=O)NCC(F)(F)CO.
What is the InChIKey of 3-amino-N-(2,2-difluoro-3-hydroxypropyl)bicyclo[2.2.1]heptane-2-carboxamide?
The InChIKey is OIHMZFBCQJRYSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F2N2O2/c12-11(13,5-16)4-15-10(17)8-6-1-2-7(3-6)9(8)14/h6-9,16H,1-5,14H2,(H,15,17).
What are the key properties of 3-amino-N-(2,2-difluoro-3-hydroxypropyl)bicyclo[2.2.1]heptane-2-carboxamide?
3-amino-N-(2,2-difluoro-3-hydroxypropyl)bicyclo[2.2.1]heptane-2-carboxamide has a molecular weight of 248.27 g/mol, XLogP of 0.10, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-N-(2,2-difluoro-3-hydroxypropyl)bicyclo[2.2.1]heptane-2-carboxamide is sourced from PubChem (CID 114154225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).