C10H11N3O6 — CID 114154296
3-[(3-amino-2-hydroxy-3-oxopropyl)amino]-2-nitrobenzoic acid (PubChem CID 114154296) has the molecular formula C10H11N3O6 and a molecular weight of 269.21 g/mol. Its IUPAC name is 3-[(3-amino-2-hydroxy-3-oxopropyl)amino]-2-nitrobenzoic acid.
| Compound Name | 3-[(3-amino-2-hydroxy-3-oxopropyl)amino]-2-nitrobenzoic acid |
|---|---|
| PubChem CID | 114154296 |
| Molecular Formula | C10H11N3O6 |
| Molecular Weight | 269.21 g/mol |
| Exact Mass | 269.06 |
| IUPAC Name | 3-[(3-amino-2-hydroxy-3-oxopropyl)amino]-2-nitrobenzoic acid |
| SMILES | NC(=O)C(O)CNc1cccc(C(=O)O)c1[N+](=O)[O-] |
| InChI | InChI=1S/C10H11N3O6/c11-9(15)7(14)4-12-6-3-1-2-5(10(16)17)8(6)13(18)19/h1-3,7,12,14H,4H2,(H2,11,15)(H,16,17) |
| InChIKey | BPIWFOBLUKQEBK-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 155.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.21 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|