C11H15IO2 — CID 11415508
2-(iodomethyl)-6,6-dimethyl-2,3,5,7-tetrahydro-1-benzofuran-4-one (PubChem CID 11415508) has the molecular formula C11H15IO2 and a molecular weight of 306.14 g/mol. Its IUPAC name is 2-(iodomethyl)-6,6-dimethyl-2,3,5,7-tetrahydro-1-benzofuran-4-one.
| Compound Name | 2-(iodomethyl)-6,6-dimethyl-2,3,5,7-tetrahydro-1-benzofuran-4-one |
|---|---|
| PubChem CID | 11415508 |
| Molecular Formula | C11H15IO2 |
| Molecular Weight | 306.14 g/mol |
| Exact Mass | 306.01 |
| IUPAC Name | 2-(iodomethyl)-6,6-dimethyl-2,3,5,7-tetrahydro-1-benzofuran-4-one |
| SMILES | CC1(C)CC(=O)C2=C(C1)OC(CI)C2 |
| InChI | InChI=1S/C11H15IO2/c1-11(2)4-9(13)8-3-7(6-12)14-10(8)5-11/h7H,3-6H2,1-2H3 |
| InChIKey | FUOHHDDFNGSXJM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.14 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|