About 2-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pyrimidine-5-sulfonamide
2-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pyrimidine-5-sulfonamide (PubChem CID 114155588) has the molecular formula C10H16ClN3O3S
and a molecular weight of 293.78 g/mol. Its IUPAC name is 2-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pyrimidine-5-sulfonamide.
Molecular Properties
| Compound Name | 2-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pyrimidine-5-sulfonamide |
| PubChem CID | 114155588 |
| Molecular Formula | C10H16ClN3O3S |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.06 |
| IUPAC Name | 2-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pyrimidine-5-sulfonamide |
| SMILES | CC(C)(O)C(C)(C)NS(=O)(=O)c1cnc(Cl)nc1 |
| InChI | InChI=1S/C10H16ClN3O3S/c1-9(2,10(3,4)15)14-18(16,17)7-5-12-8(11)13-6-7/h5-6,14-15H,1-4H3 |
| InChIKey | MUGNJVKQBDRSGO-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 92.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pyrimidine-5-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pyrimidine-5-sulfonamide?
The IUPAC name of 2-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pyrimidine-5-sulfonamide (CID 114155588) is 2-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pyrimidine-5-sulfonamide.
What is the SMILES notation for 2-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pyrimidine-5-sulfonamide?
The canonical SMILES for 2-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pyrimidine-5-sulfonamide is CC(C)(O)C(C)(C)NS(=O)(=O)c1cnc(Cl)nc1.
What is the InChIKey of 2-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pyrimidine-5-sulfonamide?
The InChIKey is MUGNJVKQBDRSGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16ClN3O3S/c1-9(2,10(3,4)15)14-18(16,17)7-5-12-8(11)13-6-7/h5-6,14-15H,1-4H3.
What are the key properties of 2-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pyrimidine-5-sulfonamide?
2-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pyrimidine-5-sulfonamide has a molecular weight of 293.78 g/mol, XLogP of 0.96, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-N-(3-hydroxy-2,3-dimethylbutan-2-yl)pyrimidine-5-sulfonamide is sourced from PubChem (CID 114155588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).