C11H17F3N2O — CID 114155599
N-(3-methylbut-2-enyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide (PubChem CID 114155599) has the molecular formula C11H17F3N2O and a molecular weight of 250.26 g/mol. Its IUPAC name is N-(3-methylbut-2-enyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide.
| Compound Name | N-(3-methylbut-2-enyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 114155599 |
| Molecular Formula | C11H17F3N2O |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-(3-methylbut-2-enyl)-3-(trifluoromethyl)pyrrolidine-3-carboxamide |
| SMILES | CC(C)=CCNC(=O)C1(C(F)(F)F)CCNC1 |
| InChI | InChI=1S/C11H17F3N2O/c1-8(2)3-5-16-9(17)10(11(12,13)14)4-6-15-7-10/h3,15H,4-7H2,1-2H3,(H,16,17) |
| InChIKey | LTGOHERIDJRLAM-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|