C13H14Cl2N4 — CID 114156465
4,6-dichloro-N-(2-methyl-2-phenylpropyl)-1,3,5-triazin-2-amine (PubChem CID 114156465) has the molecular formula C13H14Cl2N4 and a molecular weight of 297.19 g/mol. Its IUPAC name is 4,6-dichloro-N-(2-methyl-2-phenylpropyl)-1,3,5-triazin-2-amine.
| Compound Name | 4,6-dichloro-N-(2-methyl-2-phenylpropyl)-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 114156465 |
| Molecular Formula | C13H14Cl2N4 |
| Molecular Weight | 297.19 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | 4,6-dichloro-N-(2-methyl-2-phenylpropyl)-1,3,5-triazin-2-amine |
| SMILES | CC(C)(CNc1nc(Cl)nc(Cl)n1)c1ccccc1 |
| InChI | InChI=1S/C13H14Cl2N4/c1-13(2,9-6-4-3-5-7-9)8-16-12-18-10(14)17-11(15)19-12/h3-7H,8H2,1-2H3,(H,16,17,18,19) |
| InChIKey | MEORRHDTQAZBBO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 50.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.19 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |