C12H14ClN5 — CID 114156779
5-chloro-N-cyclohex-3-en-1-yl-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine (PubChem CID 114156779) has the molecular formula C12H14ClN5 and a molecular weight of 263.73 g/mol. Its IUPAC name is 5-chloro-N-cyclohex-3-en-1-yl-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine.
| Compound Name | 5-chloro-N-cyclohex-3-en-1-yl-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
|---|---|
| PubChem CID | 114156779 |
| Molecular Formula | C12H14ClN5 |
| Molecular Weight | 263.73 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 5-chloro-N-cyclohex-3-en-1-yl-6-methyl-[1,2,4]triazolo[1,5-a]pyrimidin-7-amine |
| SMILES | Cc1c(Cl)nc2ncnn2c1NC1CC=CCC1 |
| InChI | InChI=1S/C12H14ClN5/c1-8-10(13)17-12-14-7-15-18(12)11(8)16-9-5-3-2-4-6-9/h2-3,7,9,16H,4-6H2,1H3 |
| InChIKey | FIMYGTRNQDYXPR-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 55.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.73 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|