C12H20N4O — CID 114156977
5-tert-butyl-N-(3-methylbut-2-enyl)-1H-1,2,4-triazole-3-carboxamide (PubChem CID 114156977) has the molecular formula C12H20N4O and a molecular weight of 236.32 g/mol. Its IUPAC name is 5-tert-butyl-N-(3-methylbut-2-enyl)-1H-1,2,4-triazole-3-carboxamide.
| Compound Name | 5-tert-butyl-N-(3-methylbut-2-enyl)-1H-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 114156977 |
| Molecular Formula | C12H20N4O |
| Molecular Weight | 236.32 g/mol |
| Exact Mass | 236.16 |
| IUPAC Name | 5-tert-butyl-N-(3-methylbut-2-enyl)-1H-1,2,4-triazole-3-carboxamide |
| SMILES | CC(C)=CCNC(=O)c1n[nH]c(C(C)(C)C)n1 |
| InChI | InChI=1S/C12H20N4O/c1-8(2)6-7-13-10(17)9-14-11(16-15-9)12(3,4)5/h6H,7H2,1-5H3,(H,13,17)(H,14,15,16) |
| InChIKey | JUVBCQKGCRFMDA-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|