C11H20N4O2 — CID 114157111
3-methoxy-2-[[6-(propylamino)pyrimidin-4-yl]amino]propan-1-ol (PubChem CID 114157111) has the molecular formula C11H20N4O2 and a molecular weight of 240.31 g/mol. Its IUPAC name is 3-methoxy-2-[[6-(propylamino)pyrimidin-4-yl]amino]propan-1-ol.
| Compound Name | 3-methoxy-2-[[6-(propylamino)pyrimidin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 114157111 |
| Molecular Formula | C11H20N4O2 |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.16 |
| IUPAC Name | 3-methoxy-2-[[6-(propylamino)pyrimidin-4-yl]amino]propan-1-ol |
| SMILES | CCCNc1cc(NC(CO)COC)ncn1 |
| InChI | InChI=1S/C11H20N4O2/c1-3-4-12-10-5-11(14-8-13-10)15-9(6-16)7-17-2/h5,8-9,16H,3-4,6-7H2,1-2H3,(H2,12,13,14,15) |
| InChIKey | NGYNWXGFBLQFOO-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 79.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |