C14H18O2S — CID 114157752
4-[5-(2-cyclopropylethoxymethyl)thiophen-2-yl]but-3-yn-1-ol (PubChem CID 114157752) has the molecular formula C14H18O2S and a molecular weight of 250.36 g/mol. Its IUPAC name is 4-[5-(2-cyclopropylethoxymethyl)thiophen-2-yl]but-3-yn-1-ol.
| Compound Name | 4-[5-(2-cyclopropylethoxymethyl)thiophen-2-yl]but-3-yn-1-ol |
|---|---|
| PubChem CID | 114157752 |
| Molecular Formula | C14H18O2S |
| Molecular Weight | 250.36 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | 4-[5-(2-cyclopropylethoxymethyl)thiophen-2-yl]but-3-yn-1-ol |
| SMILES | OCCC#Cc1ccc(COCCC2CC2)s1 |
| InChI | InChI=1S/C14H18O2S/c15-9-2-1-3-13-6-7-14(17-13)11-16-10-8-12-4-5-12/h6-7,12,15H,2,4-5,8-11H2 |
| InChIKey | RTQYKQAEEGQVHD-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|