C12H15N3OS — CID 114157912
2-(2-cyclopropylethoxymethyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 114157912) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is 2-(2-cyclopropylethoxymethyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | 2-(2-cyclopropylethoxymethyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 114157912 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 2-(2-cyclopropylethoxymethyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Nc1nc(COCCC2CC2)nc2sccc12 |
| InChI | InChI=1S/C12H15N3OS/c13-11-9-4-6-17-12(9)15-10(14-11)7-16-5-3-8-1-2-8/h4,6,8H,1-3,5,7H2,(H2,13,14,15) |
| InChIKey | WGHQCKXKPGIYDI-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|