C11H12ClN5O — CID 114158282
5-amino-2-chloro-N-[1-(1H-pyrazol-4-yl)ethyl]pyridine-4-carboxamide (PubChem CID 114158282) has the molecular formula C11H12ClN5O and a molecular weight of 265.70 g/mol. Its IUPAC name is 5-amino-2-chloro-N-[1-(1H-pyrazol-4-yl)ethyl]pyridine-4-carboxamide.
| Compound Name | 5-amino-2-chloro-N-[1-(1H-pyrazol-4-yl)ethyl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 114158282 |
| Molecular Formula | C11H12ClN5O |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 5-amino-2-chloro-N-[1-(1H-pyrazol-4-yl)ethyl]pyridine-4-carboxamide |
| SMILES | CC(NC(=O)c1cc(Cl)ncc1N)c1cn[nH]c1 |
| InChI | InChI=1S/C11H12ClN5O/c1-6(7-3-15-16-4-7)17-11(18)8-2-10(12)14-5-9(8)13/h2-6H,13H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | KPSDJNXGQSTWQE-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|