C13H18F3N — CID 114158619
N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-1-(trifluoromethyl)cyclopropan-1-amine (PubChem CID 114158619) has the molecular formula C13H18F3N and a molecular weight of 245.29 g/mol. Its IUPAC name is N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-1-(trifluoromethyl)cyclopropan-1-amine.
| Compound Name | N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-1-(trifluoromethyl)cyclopropan-1-amine |
|---|---|
| PubChem CID | 114158619 |
| Molecular Formula | C13H18F3N |
| Molecular Weight | 245.29 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethyl]-1-(trifluoromethyl)cyclopropan-1-amine |
| SMILES | CC(NC1(C(F)(F)F)CC1)C1CC2C=CC1C2 |
| InChI | InChI=1S/C13H18F3N/c1-8(11-7-9-2-3-10(11)6-9)17-12(4-5-12)13(14,15)16/h2-3,8-11,17H,4-7H2,1H3 |
| InChIKey | DKPCPPCHKSQAFR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.29 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|