C10H9F3N2O3 — CID 114158728
7-[1-(trifluoromethyl)cyclopropyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione (PubChem CID 114158728) has the molecular formula C10H9F3N2O3 and a molecular weight of 262.19 g/mol. Its IUPAC name is 7-[1-(trifluoromethyl)cyclopropyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione.
| Compound Name | 7-[1-(trifluoromethyl)cyclopropyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione |
|---|---|
| PubChem CID | 114158728 |
| Molecular Formula | C10H9F3N2O3 |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 7-[1-(trifluoromethyl)cyclopropyl]-5,7-diazaspiro[2.5]octane-4,6,8-trione |
| SMILES | O=C1NC(=O)C2(CC2)C(=O)N1C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C10H9F3N2O3/c11-10(12,13)9(3-4-9)15-6(17)8(1-2-8)5(16)14-7(15)18/h1-4H2,(H,14,16,18) |
| InChIKey | QLRWNUUHKKZQJW-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|