C13H23F3N2 — CID 114158826
5-tert-butyl-2-methyl-1-[1-(trifluoromethyl)cyclopropyl]piperazine (PubChem CID 114158826) has the molecular formula C13H23F3N2 and a molecular weight of 264.33 g/mol. Its IUPAC name is 5-tert-butyl-2-methyl-1-[1-(trifluoromethyl)cyclopropyl]piperazine.
| Compound Name | 5-tert-butyl-2-methyl-1-[1-(trifluoromethyl)cyclopropyl]piperazine |
|---|---|
| PubChem CID | 114158826 |
| Molecular Formula | C13H23F3N2 |
| Molecular Weight | 264.33 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 5-tert-butyl-2-methyl-1-[1-(trifluoromethyl)cyclopropyl]piperazine |
| SMILES | CC1CNC(C(C)(C)C)CN1C1(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H23F3N2/c1-9-7-17-10(11(2,3)4)8-18(9)12(5-6-12)13(14,15)16/h9-10,17H,5-8H2,1-4H3 |
| InChIKey | YZKDKLBYVNSZLZ-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |