C9H9F3N4O2 — CID 114159816
3-nitro-2-N-[1-(trifluoromethyl)cyclopropyl]pyridine-2,6-diamine (PubChem CID 114159816) has the molecular formula C9H9F3N4O2 and a molecular weight of 262.19 g/mol. Its IUPAC name is 3-nitro-2-N-[1-(trifluoromethyl)cyclopropyl]pyridine-2,6-diamine.
| Compound Name | 3-nitro-2-N-[1-(trifluoromethyl)cyclopropyl]pyridine-2,6-diamine |
|---|---|
| PubChem CID | 114159816 |
| Molecular Formula | C9H9F3N4O2 |
| Molecular Weight | 262.19 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | 3-nitro-2-N-[1-(trifluoromethyl)cyclopropyl]pyridine-2,6-diamine |
| SMILES | Nc1ccc([N+](=O)[O-])c(NC2(C(F)(F)F)CC2)n1 |
| InChI | InChI=1S/C9H9F3N4O2/c10-9(11,12)8(3-4-8)15-7-5(16(17)18)1-2-6(13)14-7/h1-2H,3-4H2,(H3,13,14,15) |
| InChIKey | QOLMPCNBMIEUGD-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 94.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|