C16H22N2 — CID 114160139
2-methyl-1-pent-4-ynyl-5-phenylpiperazine (PubChem CID 114160139) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-methyl-1-pent-4-ynyl-5-phenylpiperazine.
| Compound Name | 2-methyl-1-pent-4-ynyl-5-phenylpiperazine |
|---|---|
| PubChem CID | 114160139 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2-methyl-1-pent-4-ynyl-5-phenylpiperazine |
| SMILES | C#CCCCN1CC(c2ccccc2)NCC1C |
| InChI | InChI=1S/C16H22N2/c1-3-4-8-11-18-13-16(17-12-14(18)2)15-9-6-5-7-10-15/h1,5-7,9-10,14,16-17H,4,8,11-13H2,2H3 |
| InChIKey | JXPHRBPXKVYWAI-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|