C15H26N2 — CID 114160540
2-pent-1-yn-3-yl-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine (PubChem CID 114160540) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is 2-pent-1-yn-3-yl-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine.
| Compound Name | 2-pent-1-yn-3-yl-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
|---|---|
| PubChem CID | 114160540 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | 2-pent-1-yn-3-yl-3-propan-2-yl-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazine |
| SMILES | C#CC(CC)N1CC2CCCN2CC1C(C)C |
| InChI | InChI=1S/C15H26N2/c1-5-13(6-2)17-10-14-8-7-9-16(14)11-15(17)12(3)4/h1,12-15H,6-11H2,2-4H3 |
| InChIKey | WGTZHVCKSQYHPS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|