C16H21N — CID 114160632
N-[cyclopropyl-(4-methylphenyl)methyl]pent-1-yn-3-amine (PubChem CID 114160632) has the molecular formula C16H21N and a molecular weight of 227.35 g/mol. Its IUPAC name is N-[cyclopropyl-(4-methylphenyl)methyl]pent-1-yn-3-amine.
| Compound Name | N-[cyclopropyl-(4-methylphenyl)methyl]pent-1-yn-3-amine |
|---|---|
| PubChem CID | 114160632 |
| Molecular Formula | C16H21N |
| Molecular Weight | 227.35 g/mol |
| Exact Mass | 227.17 |
| IUPAC Name | N-[cyclopropyl-(4-methylphenyl)methyl]pent-1-yn-3-amine |
| SMILES | C#CC(CC)NC(c1ccc(C)cc1)C1CC1 |
| InChI | InChI=1S/C16H21N/c1-4-15(5-2)17-16(14-10-11-14)13-8-6-12(3)7-9-13/h1,6-9,14-17H,5,10-11H2,2-3H3 |
| InChIKey | KGSQVHZDYZMPGO-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|