C15H27N3 — CID 114161007
1-(aminomethyl)-N-hex-1-yn-3-yl-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-amine (PubChem CID 114161007) has the molecular formula C15H27N3 and a molecular weight of 249.40 g/mol. Its IUPAC name is 1-(aminomethyl)-N-hex-1-yn-3-yl-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-amine.
| Compound Name | 1-(aminomethyl)-N-hex-1-yn-3-yl-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-amine |
|---|---|
| PubChem CID | 114161007 |
| Molecular Formula | C15H27N3 |
| Molecular Weight | 249.40 g/mol |
| Exact Mass | 249.22 |
| IUPAC Name | 1-(aminomethyl)-N-hex-1-yn-3-yl-3,5,6,7,8,8a-hexahydro-2H-indolizin-1-amine |
| SMILES | C#CC(CCC)NC1(CN)CCN2CCCCC21 |
| InChI | InChI=1S/C15H27N3/c1-3-7-13(4-2)17-15(12-16)9-11-18-10-6-5-8-14(15)18/h2,13-14,17H,3,5-12,16H2,1H3 |
| InChIKey | BZSZPDAXBJMKHG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|