C13H13N3O2 — CID 114161382
2-(pent-1-yn-3-ylamino)imidazo[1,2-a]pyridine-3-carboxylic acid (PubChem CID 114161382) has the molecular formula C13H13N3O2 and a molecular weight of 243.27 g/mol. Its IUPAC name is 2-(pent-1-yn-3-ylamino)imidazo[1,2-a]pyridine-3-carboxylic acid.
| Compound Name | 2-(pent-1-yn-3-ylamino)imidazo[1,2-a]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 114161382 |
| Molecular Formula | C13H13N3O2 |
| Molecular Weight | 243.27 g/mol |
| Exact Mass | 243.10 |
| IUPAC Name | 2-(pent-1-yn-3-ylamino)imidazo[1,2-a]pyridine-3-carboxylic acid |
| SMILES | C#CC(CC)Nc1nc2ccccn2c1C(=O)O |
| InChI | InChI=1S/C13H13N3O2/c1-3-9(4-2)14-12-11(13(17)18)16-8-6-5-7-10(16)15-12/h1,5-9,14H,4H2,2H3,(H,17,18) |
| InChIKey | DAXIRYLMIHPJAB-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.27 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|