C14H19ClN2O — CID 114161759
5-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]pentanamide (PubChem CID 114161759) has the molecular formula C14H19ClN2O and a molecular weight of 266.77 g/mol. Its IUPAC name is 5-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]pentanamide.
| Compound Name | 5-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]pentanamide |
|---|---|
| PubChem CID | 114161759 |
| Molecular Formula | C14H19ClN2O |
| Molecular Weight | 266.77 g/mol |
| Exact Mass | 266.12 |
| IUPAC Name | 5-[(5-chloro-2,3-dihydro-1H-inden-2-yl)amino]pentanamide |
| SMILES | NC(=O)CCCCNC1Cc2ccc(Cl)cc2C1 |
| InChI | InChI=1S/C14H19ClN2O/c15-12-5-4-10-8-13(9-11(10)7-12)17-6-2-1-3-14(16)18/h4-5,7,13,17H,1-3,6,8-9H2,(H2,16,18) |
| InChIKey | SGTCQXAOHHDQJV-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.77 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|