C10H19N3O5 — CID 114162542
2-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl-methylamino]butanoic acid (PubChem CID 114162542) has the molecular formula C10H19N3O5 and a molecular weight of 261.28 g/mol. Its IUPAC name is 2-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl-methylamino]butanoic acid.
| Compound Name | 2-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl-methylamino]butanoic acid |
|---|---|
| PubChem CID | 114162542 |
| Molecular Formula | C10H19N3O5 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 2-[2-(2-amino-2-oxoethoxy)ethylcarbamoyl-methylamino]butanoic acid |
| SMILES | CCC(C(=O)O)N(C)C(=O)NCCOCC(N)=O |
| InChI | InChI=1S/C10H19N3O5/c1-3-7(9(15)16)13(2)10(17)12-4-5-18-6-8(11)14/h7H,3-6H2,1-2H3,(H2,11,14)(H,12,17)(H,15,16) |
| InChIKey | QURWQLYPXSWOLN-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|