C16H32O5Si — CID 11416317
(4aR,6S,7R,8aS)-2,2-ditert-butyl-6-(2-hydroxyethyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol (PubChem CID 11416317) has the molecular formula C16H32O5Si and a molecular weight of 332.51 g/mol. Its IUPAC name is (4aR,6S,7R,8aS)-2,2-ditert-butyl-6-(2-hydroxyethyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol.
| Compound Name | (4aR,6S,7R,8aS)-2,2-ditert-butyl-6-(2-hydroxyethyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol |
|---|---|
| PubChem CID | 11416317 |
| Molecular Formula | C16H32O5Si |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | (4aR,6S,7R,8aS)-2,2-ditert-butyl-6-(2-hydroxyethyl)-4,4a,6,7,8,8a-hexahydropyrano[3,2-d][1,3,2]dioxasilin-7-ol |
| SMILES | CC(C)(C)[Si]1(C(C)(C)C)OC[C@H]2O[C@@H](CCO)[C@H](O)C[C@@H]2O1 |
| InChI | InChI=1S/C16H32O5Si/c1-15(2,3)22(16(4,5)6)19-10-14-13(21-22)9-11(18)12(20-14)7-8-17/h11-14,17-18H,7-10H2,1-6H3/t11-,12+,13+,14-/m1/s1 |
| InChIKey | UDDKTTBXOBJUKO-ZOBORPQBSA-N |
| XLogP | 2.35 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|