C12H16BrNO4 — CID 114163848
2-bromo-4-[(3-hydroxy-4-methoxybutyl)amino]benzoic acid (PubChem CID 114163848) has the molecular formula C12H16BrNO4 and a molecular weight of 318.17 g/mol. Its IUPAC name is 2-bromo-4-[(3-hydroxy-4-methoxybutyl)amino]benzoic acid.
| Compound Name | 2-bromo-4-[(3-hydroxy-4-methoxybutyl)amino]benzoic acid |
|---|---|
| PubChem CID | 114163848 |
| Molecular Formula | C12H16BrNO4 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.03 |
| IUPAC Name | 2-bromo-4-[(3-hydroxy-4-methoxybutyl)amino]benzoic acid |
| SMILES | COCC(O)CCNc1ccc(C(=O)O)c(Br)c1 |
| InChI | InChI=1S/C12H16BrNO4/c1-18-7-9(15)4-5-14-8-2-3-10(12(16)17)11(13)6-8/h2-3,6,9,14-15H,4-5,7H2,1H3,(H,16,17) |
| InChIKey | DIXOVMQRHZGYIE-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |