About 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-1-methylpyrrolidin-2-one
3-[(6-amino-1,3-benzothiazol-2-yl)amino]-1-methylpyrrolidin-2-one (PubChem CID 114164231) has the molecular formula C12H14N4OS
and a molecular weight of 262.34 g/mol. Its IUPAC name is 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-1-methylpyrrolidin-2-one.
Molecular Properties
| Compound Name | 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-1-methylpyrrolidin-2-one |
| PubChem CID | 114164231 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-1-methylpyrrolidin-2-one |
| SMILES | CN1CCC(Nc2nc3ccc(N)cc3s2)C1=O |
| InChI | InChI=1S/C12H14N4OS/c1-16-5-4-9(11(16)17)15-12-14-8-3-2-7(13)6-10(8)18-12/h2-3,6,9H,4-5,13H2,1H3,(H,14,15) |
| InChIKey | UASVZEUBQXVYGT-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-1-methylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-1-methylpyrrolidin-2-one?
The IUPAC name of 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-1-methylpyrrolidin-2-one (CID 114164231) is 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-1-methylpyrrolidin-2-one.
What is the SMILES notation for 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-1-methylpyrrolidin-2-one?
The canonical SMILES for 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-1-methylpyrrolidin-2-one is CN1CCC(Nc2nc3ccc(N)cc3s2)C1=O.
What is the InChIKey of 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-1-methylpyrrolidin-2-one?
The InChIKey is UASVZEUBQXVYGT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N4OS/c1-16-5-4-9(11(16)17)15-12-14-8-3-2-7(13)6-10(8)18-12/h2-3,6,9H,4-5,13H2,1H3,(H,14,15).
What are the key properties of 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-1-methylpyrrolidin-2-one?
3-[(6-amino-1,3-benzothiazol-2-yl)amino]-1-methylpyrrolidin-2-one has a molecular weight of 262.34 g/mol, XLogP of 1.52, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6-amino-1,3-benzothiazol-2-yl)amino]-1-methylpyrrolidin-2-one is sourced from PubChem (CID 114164231), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).