C14H20BrClFN — CID 114164302
N-[(4-bromo-2-fluorophenyl)methyl]-2-(chloromethyl)-2-ethylbutan-1-amine (PubChem CID 114164302) has the molecular formula C14H20BrClFN and a molecular weight of 336.68 g/mol. Its IUPAC name is N-[(4-bromo-2-fluorophenyl)methyl]-2-(chloromethyl)-2-ethylbutan-1-amine.
| Compound Name | N-[(4-bromo-2-fluorophenyl)methyl]-2-(chloromethyl)-2-ethylbutan-1-amine |
|---|---|
| PubChem CID | 114164302 |
| Molecular Formula | C14H20BrClFN |
| Molecular Weight | 336.68 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | N-[(4-bromo-2-fluorophenyl)methyl]-2-(chloromethyl)-2-ethylbutan-1-amine |
| SMILES | CCC(CC)(CCl)CNCc1ccc(Br)cc1F |
| InChI | InChI=1S/C14H20BrClFN/c1-3-14(4-2,9-16)10-18-8-11-5-6-12(15)7-13(11)17/h5-7,18H,3-4,8-10H2,1-2H3 |
| InChIKey | PTNUCGOJEXMHSO-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.68 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|