C22H26O3 — CID 11416475
(E)-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]prop-2-enoic acid (PubChem CID 11416475) has the molecular formula C22H26O3 and a molecular weight of 338.45 g/mol. Its IUPAC name is (E)-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 11416475 |
| Molecular Formula | C22H26O3 |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | (E)-3-[4-[(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)methyl]furan-2-yl]prop-2-enoic acid |
| SMILES | CC1(C)CCC(C)(C)c2cc(Cc3coc(/C=C/C(=O)O)c3)ccc21 |
| InChI | InChI=1S/C22H26O3/c1-21(2)9-10-22(3,4)19-13-15(5-7-18(19)21)11-16-12-17(25-14-16)6-8-20(23)24/h5-8,12-14H,9-11H2,1-4H3,(H,23,24)/b8-6+ |
| InChIKey | GPLSMLHEZAREAH-SOFGYWHQSA-N |
| XLogP | 5.32 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|