C18H26O2S2 — CID 11416483
(4E,6E)-7-ethoxy-2,2-dimethyl-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol (PubChem CID 11416483) has the molecular formula C18H26O2S2 and a molecular weight of 338.54 g/mol. Its IUPAC name is (4E,6E)-7-ethoxy-2,2-dimethyl-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol.
| Compound Name | (4E,6E)-7-ethoxy-2,2-dimethyl-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol |
|---|---|
| PubChem CID | 11416483 |
| Molecular Formula | C18H26O2S2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | (4E,6E)-7-ethoxy-2,2-dimethyl-5-methylsulfanyl-4-phenylsulfanylhepta-4,6-dien-3-ol |
| SMILES | CCO/C=C/C(SC)=C(\Sc1ccccc1)C(O)C(C)(C)C |
| InChI | InChI=1S/C18H26O2S2/c1-6-20-13-12-15(21-5)16(17(19)18(2,3)4)22-14-10-8-7-9-11-14/h7-13,17,19H,6H2,1-5H3/b13-12+,16-15+ |
| InChIKey | LBDRLQYGNRKMPS-XUPYMNJSSA-N |
| XLogP | 5.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|