C20H40O2Si — CID 11416545
(5S,6S,7E,9E)-5,7,9-trimethyl-6-triethylsilyloxyundeca-7,9-dien-4-ol (PubChem CID 11416545) has the molecular formula C20H40O2Si and a molecular weight of 340.62 g/mol. Its IUPAC name is (5S,6S,7E,9E)-5,7,9-trimethyl-6-triethylsilyloxyundeca-7,9-dien-4-ol.
| Compound Name | (5S,6S,7E,9E)-5,7,9-trimethyl-6-triethylsilyloxyundeca-7,9-dien-4-ol |
|---|---|
| PubChem CID | 11416545 |
| Molecular Formula | C20H40O2Si |
| Molecular Weight | 340.62 g/mol |
| Exact Mass | 340.28 |
| IUPAC Name | (5S,6S,7E,9E)-5,7,9-trimethyl-6-triethylsilyloxyundeca-7,9-dien-4-ol |
| SMILES | C/C=C(C)/C=C(\C)[C@@H](O[Si](CC)(CC)CC)[C@@H](C)C(O)CCC |
| InChI | InChI=1S/C20H40O2Si/c1-9-14-19(21)18(8)20(17(7)15-16(6)10-2)22-23(11-3,12-4)13-5/h10,15,18-21H,9,11-14H2,1-8H3/b16-10+,17-15+/t18-,19?,20+/m0/s1 |
| InChIKey | PDSXQSMYJKOSKE-CLLRNREQSA-N |
| XLogP | 6.09 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.62 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|