C21H30O2Si — CID 11416602
benzyl-dimethyl-[(1E,3E,5E)-7-(oxan-2-yloxy)hepta-1,3,5-trienyl]silane (PubChem CID 11416602) has the molecular formula C21H30O2Si and a molecular weight of 342.56 g/mol. Its IUPAC name is benzyl-dimethyl-[(1E,3E,5E)-7-(oxan-2-yloxy)hepta-1,3,5-trienyl]silane.
| Compound Name | benzyl-dimethyl-[(1E,3E,5E)-7-(oxan-2-yloxy)hepta-1,3,5-trienyl]silane |
|---|---|
| PubChem CID | 11416602 |
| Molecular Formula | C21H30O2Si |
| Molecular Weight | 342.56 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | benzyl-dimethyl-[(1E,3E,5E)-7-(oxan-2-yloxy)hepta-1,3,5-trienyl]silane |
| SMILES | C[Si](C)(/C=C/C=C/C=C/COC1CCCCO1)Cc1ccccc1 |
| InChI | InChI=1S/C21H30O2Si/c1-24(2,19-20-13-7-6-8-14-20)18-12-5-3-4-10-16-22-21-15-9-11-17-23-21/h3-8,10,12-14,18,21H,9,11,15-17,19H2,1-2H3/b5-3+,10-4+,18-12+ |
| InChIKey | SFSJCWCIGOADDG-JGPHJKEUSA-N |
| XLogP | 5.23 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.56 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|