About [4-(5H-pyrrolo[2,3-b]pyrazin-3-yl)phenyl] trifluoromethanesulfonate
[4-(5H-pyrrolo[2,3-b]pyrazin-3-yl)phenyl] trifluoromethanesulfonate (PubChem CID 11416612) has the molecular formula C13H8F3N3O3S
and a molecular weight of 343.29 g/mol. Its IUPAC name is [4-(5H-pyrrolo[2,3-b]pyrazin-3-yl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-(5H-pyrrolo[2,3-b]pyrazin-3-yl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 11416612 |
| Molecular Formula | C13H8F3N3O3S |
| Molecular Weight | 343.29 g/mol |
| Exact Mass | 343.02 |
| IUPAC Name | [4-(5H-pyrrolo[2,3-b]pyrazin-3-yl)phenyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(Oc1ccc(-c2cnc3cc[nH]c3n2)cc1)C(F)(F)F |
| InChI | InChI=1S/C13H8F3N3O3S/c14-13(15,16)23(20,21)22-9-3-1-8(2-4-9)11-7-18-10-5-6-17-12(10)19-11/h1-7H,(H,17,19) |
| InChIKey | YIBXXWMYRKONRE-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.29 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-(5H-pyrrolo[2,3-b]pyrazin-3-yl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(5H-pyrrolo[2,3-b]pyrazin-3-yl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [4-(5H-pyrrolo[2,3-b]pyrazin-3-yl)phenyl] trifluoromethanesulfonate (CID 11416612) is [4-(5H-pyrrolo[2,3-b]pyrazin-3-yl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-(5H-pyrrolo[2,3-b]pyrazin-3-yl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-(5H-pyrrolo[2,3-b]pyrazin-3-yl)phenyl] trifluoromethanesulfonate is O=S(=O)(Oc1ccc(-c2cnc3cc[nH]c3n2)cc1)C(F)(F)F.
What is the InChIKey of [4-(5H-pyrrolo[2,3-b]pyrazin-3-yl)phenyl] trifluoromethanesulfonate?
The InChIKey is YIBXXWMYRKONRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F3N3O3S/c14-13(15,16)23(20,21)22-9-3-1-8(2-4-9)11-7-18-10-5-6-17-12(10)19-11/h1-7H,(H,17,19).
What are the key properties of [4-(5H-pyrrolo[2,3-b]pyrazin-3-yl)phenyl] trifluoromethanesulfonate?
[4-(5H-pyrrolo[2,3-b]pyrazin-3-yl)phenyl] trifluoromethanesulfonate has a molecular weight of 343.29 g/mol, XLogP of 2.85, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(5H-pyrrolo[2,3-b]pyrazin-3-yl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 11416612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).