About 5-cyano-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide
5-cyano-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide (PubChem CID 114166332) has the molecular formula C9H9F3N2O2S2
and a molecular weight of 298.31 g/mol. Its IUPAC name is 5-cyano-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 5-cyano-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide |
| PubChem CID | 114166332 |
| Molecular Formula | C9H9F3N2O2S2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.01 |
| IUPAC Name | 5-cyano-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide |
| SMILES | N#Cc1ccc(S(=O)(=O)NCCCC(F)(F)F)s1 |
| InChI | InChI=1S/C9H9F3N2O2S2/c10-9(11,12)4-1-5-14-18(15,16)8-3-2-7(6-13)17-8/h2-3,14H,1,4-5H2 |
| InChIKey | XGOXTEAEEJFAFN-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-cyano-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyano-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide?
The IUPAC name of 5-cyano-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide (CID 114166332) is 5-cyano-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide.
What is the SMILES notation for 5-cyano-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide?
The canonical SMILES for 5-cyano-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide is N#Cc1ccc(S(=O)(=O)NCCCC(F)(F)F)s1.
What is the InChIKey of 5-cyano-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide?
The InChIKey is XGOXTEAEEJFAFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3N2O2S2/c10-9(11,12)4-1-5-14-18(15,16)8-3-2-7(6-13)17-8/h2-3,14H,1,4-5H2.
What are the key properties of 5-cyano-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide?
5-cyano-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide has a molecular weight of 298.31 g/mol, XLogP of 2.24, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyano-N-(4,4,4-trifluorobutyl)thiophene-2-sulfonamide is sourced from PubChem (CID 114166332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).